C16H20IN3O4 — CID 134519276
2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]carbamic acid (PubChem CID 134519276) has the molecular formula C16H20IN3O4 and a molecular weight of 445.26 g/mol. Its IUPAC name is 2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]carbamic acid.
| Compound Name | 2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]carbamic acid |
|---|---|
| PubChem CID | 134519276 |
| Molecular Formula | C16H20IN3O4 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]carbamic acid |
| SMILES | O=C(O)N(C/C=C/C(=O)N1CCCC1)CCOc1ccc(I)cn1 |
| InChI | InChI=1S/C16H20IN3O4/c17-13-5-6-14(18-12-13)24-11-10-20(16(22)23)9-3-4-15(21)19-7-1-2-8-19/h3-6,12H,1-2,7-11H2,(H,22,23)/b4-3+ |
| InChIKey | QTIFHANHZXCKQX-ONEGZZNKSA-N |
| XLogP | 2.22 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|