C13H15IN2O4 — CID 134519249
(4-amino-4-oxobut-2-enyl)-[2-(4-iodophenoxy)ethyl]carbamic acid (PubChem CID 134519249) has the molecular formula C13H15IN2O4 and a molecular weight of 390.18 g/mol. Its IUPAC name is (4-amino-4-oxobut-2-enyl)-[2-(4-iodophenoxy)ethyl]carbamic acid.
| Compound Name | (4-amino-4-oxobut-2-enyl)-[2-(4-iodophenoxy)ethyl]carbamic acid |
|---|---|
| PubChem CID | 134519249 |
| Molecular Formula | C13H15IN2O4 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | (4-amino-4-oxobut-2-enyl)-[2-(4-iodophenoxy)ethyl]carbamic acid |
| SMILES | NC(=O)C=CCN(CCOc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C13H15IN2O4/c14-10-3-5-11(6-4-10)20-9-8-16(13(18)19)7-1-2-12(15)17/h1-6H,7-9H2,(H2,15,17)(H,18,19) |
| InChIKey | OVQLKBYOIZBPEE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|