C36H51I2N3O8 — CID 158357919
tert-butyl N-[(E)-4-[2-hydroxyethyl(methyl)amino]-4-oxobut-2-enyl]-N-[2-(4-iodophenoxy)ethyl]carbamate;(E)-N-(2-hydroxyethyl)-7-(4-iodophenoxy)-N-methylhept-2-enamide (PubChem CID 158357919) has the molecular formula C36H51I2N3O8 and a molecular weight of 907.62 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[2-hydroxyethyl(methyl)amino]-4-oxobut-2-enyl]-N-[2-(4-iodophenoxy)ethyl]carbamate;(E)-N-(2-hydroxyethyl)-7-(4-iodophenoxy)-N-methylhept-2-enamide.
| Compound Name | tert-butyl N-[(E)-4-[2-hydroxyethyl(methyl)amino]-4-oxobut-2-enyl]-N-[2-(4-iodophenoxy)ethyl]carbamate;(E)-N-(2-hydroxyethyl)-7-(4-iodophenoxy)-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 158357919 |
| Molecular Formula | C36H51I2N3O8 |
| Molecular Weight | 907.62 g/mol |
| Exact Mass | 907.18 |
| IUPAC Name | tert-butyl N-[(E)-4-[2-hydroxyethyl(methyl)amino]-4-oxobut-2-enyl]-N-[2-(4-iodophenoxy)ethyl]carbamate;(E)-N-(2-hydroxyethyl)-7-(4-iodophenoxy)-N-methylhept-2-enamide |
| SMILES | CN(CCO)C(=O)/C=C/CCCCOc1ccc(I)cc1.CN(CCO)C(=O)/C=C/CN(CCOc1ccc(I)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29IN2O5.C16H22INO3/c1-20(2,3)28-19(26)23(11-5-6-18(25)22(4)12-14-24)13-15-27-17-9-7-16(21)8-10-17;1-18(11-12-19)16(20)6-4-2-3-5-13-21-15-9-7-14(17)8-10-15/h5-10,24H,11-15H2,1-4H3;4,6-10,19H,2-3,5,11-13H2,1H3/b6-5+;6-4+ |
| InChIKey | GTCLFLXXXOJEGX-GLIKLXNOSA-N |
| XLogP | 5.76 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|