C32H37N3O4 — CID 145199792
tert-butyl N-[(E)-4-(dimethylamino)-4-oxobut-2-enyl]-N-[2-[4-[(E)-2-phenyl-1-pyridin-4-ylethenyl]phenoxy]ethyl]carbamate (PubChem CID 145199792) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(dimethylamino)-4-oxobut-2-enyl]-N-[2-[4-[(E)-2-phenyl-1-pyridin-4-ylethenyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-(dimethylamino)-4-oxobut-2-enyl]-N-[2-[4-[(E)-2-phenyl-1-pyridin-4-ylethenyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 145199792 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | tert-butyl N-[(E)-4-(dimethylamino)-4-oxobut-2-enyl]-N-[2-[4-[(E)-2-phenyl-1-pyridin-4-ylethenyl]phenoxy]ethyl]carbamate |
| SMILES | CN(C)C(=O)/C=C/CN(CCOc1ccc(/C(=C\c2ccccc2)c2ccncc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H37N3O4/c1-32(2,3)39-31(37)35(21-9-12-30(36)34(4)5)22-23-38-28-15-13-26(14-16-28)29(27-17-19-33-20-18-27)24-25-10-7-6-8-11-25/h6-20,24H,21-23H2,1-5H3/b12-9+,29-24+ |
| InChIKey | RGOVVOMZTDUTQW-QXYUWCSOSA-N |
| XLogP | 5.93 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|