C32H42INO4Si — CID 53474073
tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[2-(4-iodophenoxy)ethyl]carbamate (PubChem CID 53474073) has the molecular formula C32H42INO4Si and a molecular weight of 659.68 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[2-(4-iodophenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[2-(4-iodophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 53474073 |
| Molecular Formula | C32H42INO4Si |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[2-(4-iodophenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCOc1ccc(I)cc1 |
| InChI | InChI=1S/C32H42INO4Si/c1-31(2,3)38-30(35)34(23-25-36-27-20-18-26(33)19-21-27)22-13-24-37-39(32(4,5)6,28-14-9-7-10-15-28)29-16-11-8-12-17-29/h7-12,14-21H,13,22-25H2,1-6H3 |
| InChIKey | WVHQXOSIBHNHFL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|