C38H57NO5Si — CID 57327216
tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[4-hydroxy-4-[(1R,4R,6R)-4-methyl-2-oxo-6-prop-2-enylcyclohexyl]butyl]carbamate (PubChem CID 57327216) has the molecular formula C38H57NO5Si and a molecular weight of 635.96 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[4-hydroxy-4-[(1R,4R,6R)-4-methyl-2-oxo-6-prop-2-enylcyclohexyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[4-hydroxy-4-[(1R,4R,6R)-4-methyl-2-oxo-6-prop-2-enylcyclohexyl]butyl]carbamate |
|---|---|
| PubChem CID | 57327216 |
| Molecular Formula | C38H57NO5Si |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 635.40 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[4-hydroxy-4-[(1R,4R,6R)-4-methyl-2-oxo-6-prop-2-enylcyclohexyl]butyl]carbamate |
| SMILES | C=CC[C@@H]1C[C@@H](C)CC(=O)[C@H]1C(O)CCCN(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H57NO5Si/c1-9-18-30-27-29(2)28-34(41)35(30)33(40)23-16-24-39(36(42)44-37(3,4)5)25-17-26-43-45(38(6,7)8,31-19-12-10-13-20-31)32-21-14-11-15-22-32/h9-15,19-22,29-30,33,35,40H,1,16-18,23-28H2,2-8H3/t29-,30-,33?,35-/m1/s1 |
| InChIKey | CKZJOJBBASGMPD-GTRCUCHYSA-N |
| XLogP | 7.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|