C29H43NO4Si — CID 53247787
trans-(1R,2R)-2-[(1R)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyheptyl]-N-methoxy-N-methylcyclopropane-1-carboxamide (PubChem CID 53247787) has the molecular formula C29H43NO4Si and a molecular weight of 497.75 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(1R)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyheptyl]-N-methoxy-N-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-[(1R)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyheptyl]-N-methoxy-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 53247787 |
| Molecular Formula | C29H43NO4Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | trans-(1R,2R)-2-[(1R)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyheptyl]-N-methoxy-N-methylcyclopropane-1-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1C[C@H]1[C@H](O)CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H43NO4Si/c1-29(2,3)35(23-16-10-8-11-17-23,24-18-12-9-13-19-24)34-21-15-7-6-14-20-27(31)25-22-26(25)28(32)30(4)33-5/h8-13,16-19,25-27,31H,6-7,14-15,20-22H2,1-5H3/t25-,26-,27-/m1/s1 |
| InChIKey | GMMQUZQZXSXWOH-ZONZVBGPSA-N |
| XLogP | 4.53 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|