C25H36ClNO2Si — CID 174145246
4-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]butanoyl chloride (PubChem CID 174145246) has the molecular formula C25H36ClNO2Si and a molecular weight of 446.11 g/mol. Its IUPAC name is 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]butanoyl chloride.
| Compound Name | 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]butanoyl chloride |
|---|---|
| PubChem CID | 174145246 |
| Molecular Formula | C25H36ClNO2Si |
| Molecular Weight | 446.11 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]butanoyl chloride |
| SMILES | CN(CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCCC(=O)Cl |
| InChI | InChI=1S/C25H36ClNO2Si/c1-25(2,3)30(22-14-7-5-8-15-22,23-16-9-6-10-17-23)29-21-12-11-19-27(4)20-13-18-24(26)28/h5-10,14-17H,11-13,18-21H2,1-4H3 |
| InChIKey | BCRSAKUKOOMPEP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|