C28H32O2Si — CID 71605137
(2E)-2-benzylidene-5-[tert-butyl(diphenyl)silyl]oxypentanal (PubChem CID 71605137) has the molecular formula C28H32O2Si and a molecular weight of 428.65 g/mol. Its IUPAC name is (2E)-2-benzylidene-5-[tert-butyl(diphenyl)silyl]oxypentanal.
| Compound Name | (2E)-2-benzylidene-5-[tert-butyl(diphenyl)silyl]oxypentanal |
|---|---|
| PubChem CID | 71605137 |
| Molecular Formula | C28H32O2Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2E)-2-benzylidene-5-[tert-butyl(diphenyl)silyl]oxypentanal |
| SMILES | CC(C)(C)[Si](OCCC/C(C=O)=C\c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O2Si/c1-28(2,3)31(26-17-9-5-10-18-26,27-19-11-6-12-20-27)30-21-13-16-25(23-29)22-24-14-7-4-8-15-24/h4-12,14-15,17-20,22-23H,13,16,21H2,1-3H3/b25-22+ |
| InChIKey | JESYCACAOWCKGE-YYDJUVGSSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|