C48H70N4O4Si2 — CID 11814793
N-[tert-butyl(diphenyl)silyl]oxy-3-[6-[[3-[[tert-butyl(diphenyl)silyl]oxy-methylamino]-3-oxopropyl]-methylamino]hexyl-methylamino]-N-methylpropanamide (PubChem CID 11814793) has the molecular formula C48H70N4O4Si2 and a molecular weight of 823.28 g/mol. Its IUPAC name is N-[tert-butyl(diphenyl)silyl]oxy-3-[6-[[3-[[tert-butyl(diphenyl)silyl]oxy-methylamino]-3-oxopropyl]-methylamino]hexyl-methylamino]-N-methylpropanamide.
| Compound Name | N-[tert-butyl(diphenyl)silyl]oxy-3-[6-[[3-[[tert-butyl(diphenyl)silyl]oxy-methylamino]-3-oxopropyl]-methylamino]hexyl-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 11814793 |
| Molecular Formula | C48H70N4O4Si2 |
| Molecular Weight | 823.28 g/mol |
| Exact Mass | 822.49 |
| IUPAC Name | N-[tert-butyl(diphenyl)silyl]oxy-3-[6-[[3-[[tert-butyl(diphenyl)silyl]oxy-methylamino]-3-oxopropyl]-methylamino]hexyl-methylamino]-N-methylpropanamide |
| SMILES | CN(CCCCCCN(C)CCC(=O)N(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCC(=O)N(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C48H70N4O4Si2/c1-47(2,3)57(41-27-17-13-18-28-41,42-29-19-14-20-30-42)55-51(9)45(53)35-39-49(7)37-25-11-12-26-38-50(8)40-36-46(54)52(10)56-58(48(4,5)6,43-31-21-15-22-32-43)44-33-23-16-24-34-44/h13-24,27-34H,11-12,25-26,35-40H2,1-10H3 |
| InChIKey | HAOFBSJBOWFJMO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.28 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|