C39H46O5Si2 — CID 70442473
2,3-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohept-2-enoic acid (PubChem CID 70442473) has the molecular formula C39H46O5Si2 and a molecular weight of 650.96 g/mol. Its IUPAC name is 2,3-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohept-2-enoic acid.
| Compound Name | 2,3-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 70442473 |
| Molecular Formula | C39H46O5Si2 |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 2,3-bis[[tert-butyl(diphenyl)silyl]oxy]-6-oxohept-2-enoic acid |
| SMILES | CC(=O)CCC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C39H46O5Si2/c1-30(40)28-29-35(43-45(38(2,3)4,31-20-12-8-13-21-31)32-22-14-9-15-23-32)36(37(41)42)44-46(39(5,6)7,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-27H,28-29H2,1-7H3,(H,41,42) |
| InChIKey | WOQIUQJMNORXFC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|