C21H28O2Si — CID 22445131
[tert-butyl(diphenyl)silyl] 2,2-dimethylpropanoate (PubChem CID 22445131) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl] 2,2-dimethylpropanoate.
| Compound Name | [tert-butyl(diphenyl)silyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22445131 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [tert-butyl(diphenyl)silyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H28O2Si/c1-20(2,3)19(22)23-24(21(4,5)6,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | VVLAIQIVODOGBH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|