C36H42O5Si2 — CID 139812746
bis[tert-butyl(diphenyl)silyl] 2-hydroxybutanedioate (PubChem CID 139812746) has the molecular formula C36H42O5Si2 and a molecular weight of 610.90 g/mol. Its IUPAC name is bis[tert-butyl(diphenyl)silyl] 2-hydroxybutanedioate.
| Compound Name | bis[tert-butyl(diphenyl)silyl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 139812746 |
| Molecular Formula | C36H42O5Si2 |
| Molecular Weight | 610.90 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | bis[tert-butyl(diphenyl)silyl] 2-hydroxybutanedioate |
| SMILES | CC(C)(C)[Si](OC(=O)CC(O)C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H42O5Si2/c1-35(2,3)42(28-19-11-7-12-20-28,29-21-13-8-14-22-29)40-33(38)27-32(37)34(39)41-43(36(4,5)6,30-23-15-9-16-24-30)31-25-17-10-18-26-31/h7-26,32,37H,27H2,1-6H3 |
| InChIKey | MIHAYWQRYZJZDI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|