C20H26O2Si — CID 91802630
[tert-butyl(diphenyl)silyl] butanoate (PubChem CID 91802630) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl] butanoate.
| Compound Name | [tert-butyl(diphenyl)silyl] butanoate |
|---|---|
| PubChem CID | 91802630 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [tert-butyl(diphenyl)silyl] butanoate |
| SMILES | CCCC(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H26O2Si/c1-5-12-19(21)22-23(20(2,3)4,17-13-8-6-9-14-17)18-15-10-7-11-16-18/h6-11,13-16H,5,12H2,1-4H3 |
| InChIKey | QHIOFAAAPJSIEG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|