C24H31BrO5Si — CID 177463160
diethyl (3S)-2-bromo-3-[tert-butyl(diphenyl)silyl]oxybutanedioate (PubChem CID 177463160) has the molecular formula C24H31BrO5Si and a molecular weight of 507.50 g/mol. Its IUPAC name is diethyl (3S)-2-bromo-3-[tert-butyl(diphenyl)silyl]oxybutanedioate.
| Compound Name | diethyl (3S)-2-bromo-3-[tert-butyl(diphenyl)silyl]oxybutanedioate |
|---|---|
| PubChem CID | 177463160 |
| Molecular Formula | C24H31BrO5Si |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | diethyl (3S)-2-bromo-3-[tert-butyl(diphenyl)silyl]oxybutanedioate |
| SMILES | CCOC(=O)C(Br)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H31BrO5Si/c1-6-28-22(26)20(25)21(23(27)29-7-2)30-31(24(3,4)5,18-14-10-8-11-15-18)19-16-12-9-13-17-19/h8-17,20-21H,6-7H2,1-5H3/t20?,21-/m1/s1 |
| InChIKey | RTZQQEKQVAYNIN-BPGUCPLFSA-N |
| XLogP | 3.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|