C26H34O4Si — CID 11080652
ethyl (E,7R)-7-[tert-butyl(diphenyl)silyl]oxy-4-oxooct-2-enoate (PubChem CID 11080652) has the molecular formula C26H34O4Si and a molecular weight of 438.64 g/mol. Its IUPAC name is ethyl (E,7R)-7-[tert-butyl(diphenyl)silyl]oxy-4-oxooct-2-enoate.
| Compound Name | ethyl (E,7R)-7-[tert-butyl(diphenyl)silyl]oxy-4-oxooct-2-enoate |
|---|---|
| PubChem CID | 11080652 |
| Molecular Formula | C26H34O4Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | ethyl (E,7R)-7-[tert-butyl(diphenyl)silyl]oxy-4-oxooct-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)CC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O4Si/c1-6-29-25(28)20-19-22(27)18-17-21(2)30-31(26(3,4)5,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,19-21H,6,17-18H2,1-5H3/b20-19+/t21-/m1/s1 |
| InChIKey | RYFXQCAWXJNXSR-RABMLOOZSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|