C33H46O5Si — CID 166444802
ethyl (2E,4S,5Z,7S,8Z,13S)-4-[tert-butyl(diphenyl)silyl]oxy-13-hydroxy-7-methoxytetradeca-2,5,8-trienoate (PubChem CID 166444802) has the molecular formula C33H46O5Si and a molecular weight of 550.81 g/mol. Its IUPAC name is ethyl (2E,4S,5Z,7S,8Z,13S)-4-[tert-butyl(diphenyl)silyl]oxy-13-hydroxy-7-methoxytetradeca-2,5,8-trienoate.
| Compound Name | ethyl (2E,4S,5Z,7S,8Z,13S)-4-[tert-butyl(diphenyl)silyl]oxy-13-hydroxy-7-methoxytetradeca-2,5,8-trienoate |
|---|---|
| PubChem CID | 166444802 |
| Molecular Formula | C33H46O5Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | ethyl (2E,4S,5Z,7S,8Z,13S)-4-[tert-butyl(diphenyl)silyl]oxy-13-hydroxy-7-methoxytetradeca-2,5,8-trienoate |
| SMILES | CCOC(=O)/C=C/[C@H](/C=C\[C@H](/C=C\CCC[C@H](C)O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H46O5Si/c1-7-37-32(35)26-25-29(24-23-28(36-6)18-12-8-11-17-27(2)34)38-39(33(3,4)5,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h9-10,12-16,18-29,34H,7-8,11,17H2,1-6H3/b18-12-,24-23-,26-25+/t27-,28-,29-/m0/s1 |
| InChIKey | NZNUOHGBJPWYLS-APKPEVTOSA-N |
| XLogP | 5.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|