C38H56O4Si2 — CID 101352563
ethyl (2E,4E,6E,8E,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-13-[tert-butyl(diphenyl)silyl]oxy-12-methyltrideca-2,4,6,8-tetraenoate (PubChem CID 101352563) has the molecular formula C38H56O4Si2 and a molecular weight of 633.03 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-13-[tert-butyl(diphenyl)silyl]oxy-12-methyltrideca-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-13-[tert-butyl(diphenyl)silyl]oxy-12-methyltrideca-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 101352563 |
| Molecular Formula | C38H56O4Si2 |
| Molecular Weight | 633.03 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | ethyl (2E,4E,6E,8E,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-13-[tert-butyl(diphenyl)silyl]oxy-12-methyltrideca-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H56O4Si2/c1-11-40-36(39)30-24-16-14-12-13-15-23-29-35(42-43(9,10)37(3,4)5)32(2)31-41-44(38(6,7)8,33-25-19-17-20-26-33)34-27-21-18-22-28-34/h12-28,30,32,35H,11,29,31H2,1-10H3/b13-12+,16-14+,23-15+,30-24+/t32-,35-/m0/s1 |
| InChIKey | AYJXYVWXZNKJRE-BOGQCQRMSA-N |
| XLogP | 8.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.03 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|