C29H48O3Si2 — CID 23248208
(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol (PubChem CID 23248208) has the molecular formula C29H48O3Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol.
| Compound Name | (2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 23248208 |
| Molecular Formula | C29H48O3Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol |
| SMILES | C[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H48O3Si2/c1-23(21-30)27(32-33(9,10)28(3,4)5)24(2)22-31-34(29(6,7)8,25-17-13-11-14-18-25)26-19-15-12-16-20-26/h11-20,23-24,27,30H,21-22H2,1-10H3/t23-,24-,27+/m0/s1 |
| InChIKey | WFBBDBSCOXSPQG-NLJOTIRTSA-N |
| XLogP | 6.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|