C34H56O4Si2 — CID 57387274
(E,4R,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2,5,7-trimethyloct-2-en-1-ol (PubChem CID 57387274) has the molecular formula C34H56O4Si2 and a molecular weight of 584.99 g/mol. Its IUPAC name is (E,4R,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2,5,7-trimethyloct-2-en-1-ol.
| Compound Name | (E,4R,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2,5,7-trimethyloct-2-en-1-ol |
|---|---|
| PubChem CID | 57387274 |
| Molecular Formula | C34H56O4Si2 |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | (E,4R,5R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2,5,7-trimethyloct-2-en-1-ol |
| SMILES | CO[C@H](/C=C(\C)CO)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H56O4Si2/c1-26(24-35)23-31(36-10)28(3)32(38-39(11,12)33(4,5)6)27(2)25-37-40(34(7,8)9,29-19-15-13-16-20-29)30-21-17-14-18-22-30/h13-23,27-28,31-32,35H,24-25H2,1-12H3/b26-23+/t27-,28-,31-,32-/m1/s1 |
| InChIKey | HTGHSRQQOMPYHR-INRFDBGXSA-N |
| XLogP | 7.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|