C30H48O3Si2 — CID 11598732
(Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhex-4-en-3-ol (PubChem CID 11598732) has the molecular formula C30H48O3Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhex-4-en-3-ol.
| Compound Name | (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhex-4-en-3-ol |
|---|---|
| PubChem CID | 11598732 |
| Molecular Formula | C30H48O3Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhex-4-en-3-ol |
| SMILES | C/C(=C/[C@@H](O)[C@H](C)CO[Si](C)(C)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H48O3Si2/c1-24(21-28(31)25(2)23-32-34(9,10)29(3,4)5)22-33-35(30(6,7)8,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-21,25,28,31H,22-23H2,1-10H3/b24-21-/t25-,28-/m1/s1 |
| InChIKey | LGAWUAQVJXXJBD-ZJRGRKBCSA-N |
| XLogP | 6.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|