C33H54O3Si2 — CID 101106261
(3R,4R,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyloct-1-en-4-ol (PubChem CID 101106261) has the molecular formula C33H54O3Si2 and a molecular weight of 554.96 g/mol. Its IUPAC name is (3R,4R,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyloct-1-en-4-ol.
| Compound Name | (3R,4R,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyloct-1-en-4-ol |
|---|---|
| PubChem CID | 101106261 |
| Molecular Formula | C33H54O3Si2 |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (3R,4R,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyloct-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H54O3Si2/c1-13-25(2)30(34)27(4)31(36-37(11,12)32(5,6)7)26(3)24-35-38(33(8,9)10,28-20-16-14-17-21-28)29-22-18-15-19-23-29/h13-23,25-27,30-31,34H,1,24H2,2-12H3/t25-,26-,27+,30-,31-/m1/s1 |
| InChIKey | KYHAWMBXUBNIOT-DZYXVEQESA-N |
| XLogP | 7.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|