C26H38O3Si — CID 132549370
tert-butyl-[(2S,3R,4R)-3-(methoxymethoxy)-2,4-dimethylhex-5-enoxy]-diphenylsilane (PubChem CID 132549370) has the molecular formula C26H38O3Si and a molecular weight of 426.67 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4R)-3-(methoxymethoxy)-2,4-dimethylhex-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3R,4R)-3-(methoxymethoxy)-2,4-dimethylhex-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 132549370 |
| Molecular Formula | C26H38O3Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl-[(2S,3R,4R)-3-(methoxymethoxy)-2,4-dimethylhex-5-enoxy]-diphenylsilane |
| SMILES | C=C[C@@H](C)[C@@H](OCOC)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O3Si/c1-8-21(2)25(28-20-27-7)22(3)19-29-30(26(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h8-18,21-22,25H,1,19-20H2,2-7H3/t21-,22+,25-/m1/s1 |
| InChIKey | XCTAZJHDYNDRSY-OTNCWRBYSA-N |
| XLogP | 5.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|