C49H70O4Si3 — CID 11457085
tert-butyl-[5-[[(2S,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilyl]oxyhept-6-enoxy]-diphenylsilane (PubChem CID 11457085) has the molecular formula C49H70O4Si3 and a molecular weight of 807.35 g/mol. Its IUPAC name is tert-butyl-[5-[[(2S,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilyl]oxyhept-6-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[5-[[(2S,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilyl]oxyhept-6-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11457085 |
| Molecular Formula | C49H70O4Si3 |
| Molecular Weight | 807.35 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | tert-butyl-[5-[[(2S,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilyl]oxyhept-6-enoxy]-diphenylsilane |
| SMILES | C=CC(CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)O[C@@H]([C@H](C)C=C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C49H70O4Si3/c1-13-40(3)47(41(4)39-51-56(49(8,9)10,45-34-23-17-24-35-45)46-36-25-18-26-37-46)53-54(11,12)52-42(14-2)29-27-28-38-50-55(48(5,6)7,43-30-19-15-20-31-43)44-32-21-16-22-33-44/h13-26,30-37,40-42,47H,1-2,27-29,38-39H2,3-12H3/t40-,41+,42?,47+/m1/s1 |
| InChIKey | SXBBTTVXDDXGKU-YOLSILBLSA-N |
| XLogP | 10.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.35 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|