C27H40OSi — CID 25058521
tert-butyl-diphenyl-undec-10-enoxysilane (PubChem CID 25058521) has the molecular formula C27H40OSi and a molecular weight of 408.70 g/mol. Its IUPAC name is tert-butyl-diphenyl-undec-10-enoxysilane.
| Compound Name | tert-butyl-diphenyl-undec-10-enoxysilane |
|---|---|
| PubChem CID | 25058521 |
| Molecular Formula | C27H40OSi |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | tert-butyl-diphenyl-undec-10-enoxysilane |
| SMILES | C=CCCCCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40OSi/c1-5-6-7-8-9-10-11-12-19-24-28-29(27(2,3)4,25-20-15-13-16-21-25)26-22-17-14-18-23-26/h5,13-18,20-23H,1,6-12,19,24H2,2-4H3 |
| InChIKey | DJKHLSRKTKUXMW-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|