C27H40O2Si — CID 90098390
(Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol (PubChem CID 90098390) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol.
| Compound Name | (Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol |
|---|---|
| PubChem CID | 90098390 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol |
| SMILES | CC(C)(C)[Si](OCCCCC/C=C\CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H40O2Si/c1-27(2,3)30(25-19-13-11-14-20-25,26-21-15-12-16-22-26)29-24-18-10-8-6-4-5-7-9-17-23-28/h4-5,11-16,19-22,28H,6-10,17-18,23-24H2,1-3H3/b5-4- |
| InChIKey | BWAQGHIHEMFLFD-PLNGDYQASA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|