C24H33FO2Si — CID 23054616
(Z)-8-[tert-butyl(diphenyl)silyl]oxy-3-fluorooct-3-en-1-ol (PubChem CID 23054616) has the molecular formula C24H33FO2Si and a molecular weight of 400.61 g/mol. Its IUPAC name is (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3-fluorooct-3-en-1-ol.
| Compound Name | (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3-fluorooct-3-en-1-ol |
|---|---|
| PubChem CID | 23054616 |
| Molecular Formula | C24H33FO2Si |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3-fluorooct-3-en-1-ol |
| SMILES | CC(C)(C)[Si](OCCCC/C=C(\F)CCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33FO2Si/c1-24(2,3)28(22-14-8-4-9-15-22,23-16-10-5-11-17-23)27-20-12-6-7-13-21(25)18-19-26/h4-5,8-11,13-17,26H,6-7,12,18-20H2,1-3H3/b21-13- |
| InChIKey | WEQBAUJLUFOGRP-BKUYFWCQSA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|