C20H25FO2Si — CID 66982894
4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-en-1-ol (PubChem CID 66982894) has the molecular formula C20H25FO2Si and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-en-1-ol.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-en-1-ol |
|---|---|
| PubChem CID | 66982894 |
| Molecular Formula | C20H25FO2Si |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-en-1-ol |
| SMILES | CC(C)(C)[Si](OCC=C(F)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25FO2Si/c1-20(2,3)24(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-15-14-17(21)16-22/h4-14,22H,15-16H2,1-3H3 |
| InChIKey | AHILSSOBRWGUOF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|