C25H34FNO3Si — CID 66982746
tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-enyl]carbamate (PubChem CID 66982746) has the molecular formula C25H34FNO3Si and a molecular weight of 443.64 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-enyl]carbamate |
|---|---|
| PubChem CID | 66982746 |
| Molecular Formula | C25H34FNO3Si |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorobut-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(F)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34FNO3Si/c1-24(2,3)30-23(28)27-19-20(26)17-18-29-31(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-17H,18-19H2,1-6H3,(H,27,28)/b20-17- |
| InChIKey | WEQUTWCYMWTJAT-JZJYNLBNSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|