C14H19FN2O3 — CID 66982920
tert-butyl N-[(Z)-2-fluoro-4-pyridin-3-yloxybut-2-enyl]carbamate (PubChem CID 66982920) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-fluoro-4-pyridin-3-yloxybut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-fluoro-4-pyridin-3-yloxybut-2-enyl]carbamate |
|---|---|
| PubChem CID | 66982920 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | tert-butyl N-[(Z)-2-fluoro-4-pyridin-3-yloxybut-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(F)=C/COc1cccnc1 |
| InChI | InChI=1S/C14H19FN2O3/c1-14(2,3)20-13(18)17-9-11(15)6-8-19-12-5-4-7-16-10-12/h4-7,10H,8-9H2,1-3H3,(H,17,18)/b11-6- |
| InChIKey | GIJIWCVINKGFFI-WDZFZDKYSA-N |
| XLogP | 2.84 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |