C22H36N2O2 — CID 11142934
tert-butyl N-[(E)-12-pyridin-3-yldodec-3-enyl]carbamate (PubChem CID 11142934) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is tert-butyl N-[(E)-12-pyridin-3-yldodec-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-12-pyridin-3-yldodec-3-enyl]carbamate |
|---|---|
| PubChem CID | 11142934 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | tert-butyl N-[(E)-12-pyridin-3-yldodec-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/C=C/CCCCCCCCc1cccnc1 |
| InChI | InChI=1S/C22H36N2O2/c1-22(2,3)26-21(25)24-18-13-11-9-7-5-4-6-8-10-12-15-20-16-14-17-23-19-20/h9,11,14,16-17,19H,4-8,10,12-13,15,18H2,1-3H3,(H,24,25)/b11-9+ |
| InChIKey | VBESLRXIRBCMPM-PKNBQFBNSA-N |
| XLogP | 5.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|