C23H38N2O — CID 122703819
(Z)-18-pyridin-3-yloctadec-9-enamide (PubChem CID 122703819) has the molecular formula C23H38N2O and a molecular weight of 358.57 g/mol. Its IUPAC name is (Z)-18-pyridin-3-yloctadec-9-enamide.
| Compound Name | (Z)-18-pyridin-3-yloctadec-9-enamide |
|---|---|
| PubChem CID | 122703819 |
| Molecular Formula | C23H38N2O |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | (Z)-18-pyridin-3-yloctadec-9-enamide |
| SMILES | NC(=O)CCCCCCC/C=C\CCCCCCCCc1cccnc1 |
| InChI | InChI=1S/C23H38N2O/c24-23(26)19-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-22-18-16-20-25-21-22/h1,3,16,18,20-21H,2,4-15,17,19H2,(H2,24,26)/b3-1- |
| InChIKey | ASKGXQLXDQQDAP-IWQZZHSRSA-N |
| XLogP | 6.13 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|