C21H36N2O — CID 23426295
(Z)-N-methoxy-N-methyl-14-pyridin-3-yltetradec-9-en-1-amine (PubChem CID 23426295) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is (Z)-N-methoxy-N-methyl-14-pyridin-3-yltetradec-9-en-1-amine.
| Compound Name | (Z)-N-methoxy-N-methyl-14-pyridin-3-yltetradec-9-en-1-amine |
|---|---|
| PubChem CID | 23426295 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | (Z)-N-methoxy-N-methyl-14-pyridin-3-yltetradec-9-en-1-amine |
| SMILES | CON(C)CCCCCCCC/C=C\CCCCc1cccnc1 |
| InChI | InChI=1S/C21H36N2O/c1-23(24-2)19-14-12-10-8-6-4-3-5-7-9-11-13-16-21-17-15-18-22-20-21/h5,7,15,17-18,20H,3-4,6,8-14,16,19H2,1-2H3/b7-5- |
| InChIKey | CFFZTNFSYWKUCA-ALCCZGGFSA-N |
| XLogP | 5.57 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|