C17H25NO — CID 10061128
(2S,4E,6E)-12-pyridin-3-yldodeca-4,6-dien-2-ol (PubChem CID 10061128) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S,4E,6E)-12-pyridin-3-yldodeca-4,6-dien-2-ol.
| Compound Name | (2S,4E,6E)-12-pyridin-3-yldodeca-4,6-dien-2-ol |
|---|---|
| PubChem CID | 10061128 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2S,4E,6E)-12-pyridin-3-yldodeca-4,6-dien-2-ol |
| SMILES | C[C@H](O)C/C=C/C=C/CCCCCc1cccnc1 |
| InChI | InChI=1S/C17H25NO/c1-16(19)11-8-6-4-2-3-5-7-9-12-17-13-10-14-18-15-17/h2,4,6,8,10,13-16,19H,3,5,7,9,11-12H2,1H3/b4-2+,8-6+/t16-/m0/s1 |
| InChIKey | KVTVYOVSAHMPHK-LOHDTLGXSA-N |
| XLogP | 4.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|