C17H23NO — CID 162940035
(2S)-12-pyridin-3-yldodeca-5,8,10-trien-2-ol (PubChem CID 162940035) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (2S)-12-pyridin-3-yldodeca-5,8,10-trien-2-ol.
| Compound Name | (2S)-12-pyridin-3-yldodeca-5,8,10-trien-2-ol |
|---|---|
| PubChem CID | 162940035 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2S)-12-pyridin-3-yldodeca-5,8,10-trien-2-ol |
| SMILES | C[C@H](O)CCC=CCC=CC=CCc1cccnc1 |
| InChI | InChI=1S/C17H23NO/c1-16(19)11-8-6-4-2-3-5-7-9-12-17-13-10-14-18-15-17/h3-7,9-10,13-16,19H,2,8,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | RPLHIGRAZKLWET-INIZCTEOSA-N |
| XLogP | 3.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|