C25H40N2O — CID 10452637
(E)-N-methoxy-N-methyl-18-pyridin-3-yloctadec-11-en-13-yn-1-amine (PubChem CID 10452637) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is (E)-N-methoxy-N-methyl-18-pyridin-3-yloctadec-11-en-13-yn-1-amine.
| Compound Name | (E)-N-methoxy-N-methyl-18-pyridin-3-yloctadec-11-en-13-yn-1-amine |
|---|---|
| PubChem CID | 10452637 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | (E)-N-methoxy-N-methyl-18-pyridin-3-yloctadec-11-en-13-yn-1-amine |
| SMILES | CON(C)CCCCCCCCCC/C=C/C#CCCCCc1cccnc1 |
| InChI | InChI=1S/C25H40N2O/c1-27(28-2)23-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20-25-21-19-22-26-24-25/h5,7,19,21-22,24H,3-4,6,8,10,12-18,20,23H2,1-2H3/b7-5+ |
| InChIKey | DCKCKRRIQLQELG-FNORWQNLSA-N |
| XLogP | 6.36 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|