C22H33FN2O — CID 162624144
N-[(E)-10-fluoro-16-pyridin-3-ylhexadec-9-en-11-ynyl]-N-methylhydroxylamine (PubChem CID 162624144) has the molecular formula C22H33FN2O and a molecular weight of 360.52 g/mol. Its IUPAC name is N-[(E)-10-fluoro-16-pyridin-3-ylhexadec-9-en-11-ynyl]-N-methylhydroxylamine.
| Compound Name | N-[(E)-10-fluoro-16-pyridin-3-ylhexadec-9-en-11-ynyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 162624144 |
| Molecular Formula | C22H33FN2O |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | N-[(E)-10-fluoro-16-pyridin-3-ylhexadec-9-en-11-ynyl]-N-methylhydroxylamine |
| SMILES | CN(O)CCCCCCCC/C=C(/F)C#CCCCCc1cccnc1 |
| InChI | InChI=1S/C22H33FN2O/c1-25(26)19-12-8-4-2-3-5-10-16-22(23)17-11-7-6-9-14-21-15-13-18-24-20-21/h13,15-16,18,20,26H,2-10,12,14,19H2,1H3/b22-16+ |
| InChIKey | XQAIINMOICETHT-CJLVFECKSA-N |
| XLogP | 5.70 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|