C24H40N2O — CID 23051666
N-(5-butylnon-4-enyl)-N-(4-pyridin-3-ylbutyl)acetamide (PubChem CID 23051666) has the molecular formula C24H40N2O and a molecular weight of 372.60 g/mol. Its IUPAC name is N-(5-butylnon-4-enyl)-N-(4-pyridin-3-ylbutyl)acetamide.
| Compound Name | N-(5-butylnon-4-enyl)-N-(4-pyridin-3-ylbutyl)acetamide |
|---|---|
| PubChem CID | 23051666 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | N-(5-butylnon-4-enyl)-N-(4-pyridin-3-ylbutyl)acetamide |
| SMILES | CCCCC(=CCCCN(CCCCc1cccnc1)C(C)=O)CCCC |
| InChI | InChI=1S/C24H40N2O/c1-4-6-13-23(14-7-5-2)15-8-10-19-26(22(3)27)20-11-9-16-24-17-12-18-25-21-24/h12,15,17-18,21H,4-11,13-14,16,19-20H2,1-3H3 |
| InChIKey | YTZGXIFGJAIPJQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|