C12H18N2O2 — CID 115163161
4-hydroxy-N-methyl-N-(2-pyridin-3-ylethyl)butanamide (PubChem CID 115163161) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-N-(2-pyridin-3-ylethyl)butanamide.
| Compound Name | 4-hydroxy-N-methyl-N-(2-pyridin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 115163161 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-hydroxy-N-methyl-N-(2-pyridin-3-ylethyl)butanamide |
| SMILES | CN(CCc1cccnc1)C(=O)CCCO |
| InChI | InChI=1S/C12H18N2O2/c1-14(12(16)5-3-9-15)8-6-11-4-2-7-13-10-11/h2,4,7,10,15H,3,5-6,8-9H2,1H3 |
| InChIKey | TWYLGRNEXDEJJJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |