C20H25ClN2O — CID 78807864
N-[(4-chlorophenyl)methyl]-N-pentyl-3-pyridin-3-ylpropanamide (PubChem CID 78807864) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-pentyl-3-pyridin-3-ylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-pentyl-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 78807864 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-pentyl-3-pyridin-3-ylpropanamide |
| SMILES | CCCCCN(Cc1ccc(Cl)cc1)C(=O)CCc1cccnc1 |
| InChI | InChI=1S/C20H25ClN2O/c1-2-3-4-14-23(16-18-7-10-19(21)11-8-18)20(24)12-9-17-6-5-13-22-15-17/h5-8,10-11,13,15H,2-4,9,12,14,16H2,1H3 |
| InChIKey | BDTGZIBWNGQJMU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|