C27H32ClN3O — CID 2726719
1-[(4-chlorophenyl)methyl]-3-(4-heptylphenyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 2726719) has the molecular formula C27H32ClN3O and a molecular weight of 450.03 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4-heptylphenyl)-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4-heptylphenyl)-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 2726719 |
| Molecular Formula | C27H32ClN3O |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4-heptylphenyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | CCCCCCCc1ccc(NC(=O)N(Cc2ccc(Cl)cc2)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C27H32ClN3O/c1-2-3-4-5-6-8-22-12-16-26(17-13-22)30-27(32)31(21-24-9-7-18-29-19-24)20-23-10-14-25(28)15-11-23/h7,9-19H,2-6,8,20-21H2,1H3,(H,30,32) |
| InChIKey | XFNFDDWFRHHAQA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|