C17H16ClN3O2 — CID 75493389
N-(4-chlorophenyl)-N'-cyclopropyl-N'-(pyridin-3-ylmethyl)oxamide (PubChem CID 75493389) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-cyclopropyl-N'-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N-(4-chlorophenyl)-N'-cyclopropyl-N'-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 75493389 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(4-chlorophenyl)-N'-cyclopropyl-N'-(pyridin-3-ylmethyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=O)N(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-13-3-5-14(6-4-13)20-16(22)17(23)21(15-7-8-15)11-12-2-1-9-19-10-12/h1-6,9-10,15H,7-8,11H2,(H,20,22) |
| InChIKey | KFGYERLNYFBIQZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|