C14H19N3O — CID 79285110
N-cyclopropyl-2-(prop-2-enylamino)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 79285110) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-cyclopropyl-2-(prop-2-enylamino)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-cyclopropyl-2-(prop-2-enylamino)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 79285110 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-cyclopropyl-2-(prop-2-enylamino)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | C=CCNCC(=O)N(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C14H19N3O/c1-2-7-15-10-14(18)17(13-5-6-13)11-12-4-3-8-16-9-12/h2-4,8-9,13,15H,1,5-7,10-11H2 |
| InChIKey | IKEFGISPRXMULE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|