C28H35N3O — CID 14851656
4-pyridin-3-yl-N-(5-pyridin-3-ylpentyl)-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 14851656) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is 4-pyridin-3-yl-N-(5-pyridin-3-ylpentyl)-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-pyridin-3-yl-N-(5-pyridin-3-ylpentyl)-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 14851656 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 4-pyridin-3-yl-N-(5-pyridin-3-ylpentyl)-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(N(CCCCCc2cccnc2)C(=O)CCCc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C28H35N3O/c1-22-18-23(2)28(24(3)19-22)31(17-6-4-5-10-25-12-8-15-29-20-25)27(32)14-7-11-26-13-9-16-30-21-26/h8-9,12-13,15-16,18-21H,4-7,10-11,14,17H2,1-3H3 |
| InChIKey | WUCNAVUUHQWKMC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|