C22H31N3O — CID 14851595
3-amino-N-(2,6-dimethylphenyl)-N-(5-pyridin-3-ylpentyl)butanamide (PubChem CID 14851595) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 3-amino-N-(2,6-dimethylphenyl)-N-(5-pyridin-3-ylpentyl)butanamide.
| Compound Name | 3-amino-N-(2,6-dimethylphenyl)-N-(5-pyridin-3-ylpentyl)butanamide |
|---|---|
| PubChem CID | 14851595 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 3-amino-N-(2,6-dimethylphenyl)-N-(5-pyridin-3-ylpentyl)butanamide |
| SMILES | Cc1cccc(C)c1N(CCCCCc1cccnc1)C(=O)CC(C)N |
| InChI | InChI=1S/C22H31N3O/c1-17-9-7-10-18(2)22(17)25(21(26)15-19(3)23)14-6-4-5-11-20-12-8-13-24-16-20/h7-10,12-13,16,19H,4-6,11,14-15,23H2,1-3H3 |
| InChIKey | UYVSZNZWCLGAPR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|