C30H33N3O3 — CID 70466593
(2S)-N-(2,6-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(6-pyridin-3-ylhexyl)propanamide (PubChem CID 70466593) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2S)-N-(2,6-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(6-pyridin-3-ylhexyl)propanamide.
| Compound Name | (2S)-N-(2,6-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(6-pyridin-3-ylhexyl)propanamide |
|---|---|
| PubChem CID | 70466593 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(6-pyridin-3-ylhexyl)propanamide |
| SMILES | Cc1cccc(C)c1N(CCCCCCc1cccnc1)C(=O)[C@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H33N3O3/c1-21-12-10-13-22(2)27(21)32(19-9-5-4-6-14-24-15-11-18-31-20-24)28(34)23(3)33-29(35)25-16-7-8-17-26(25)30(33)36/h7-8,10-13,15-18,20,23H,4-6,9,14,19H2,1-3H3/t23-/m0/s1 |
| InChIKey | JZNNDWFYNSXMAO-QHCPKHFHSA-N |
| XLogP | 5.52 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|