C23H31N5O — CID 14851645
N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide (PubChem CID 14851645) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide |
|---|---|
| PubChem CID | 14851645 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide |
| SMILES | Cc1cccc(C)c1N(CCCCCCn1ccnc1)C(=O)C(C)n1ccnc1 |
| InChI | InChI=1S/C23H31N5O/c1-19-9-8-10-20(2)22(19)28(23(29)21(3)27-16-12-25-18-27)14-7-5-4-6-13-26-15-11-24-17-26/h8-12,15-18,21H,4-7,13-14H2,1-3H3 |
| InChIKey | DSOBMNZBIWEGKD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|