About N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide
N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide (PubChem CID 14851645) has the molecular formula C23H31N5O
and a molecular weight of 393.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide.
Molecular Properties
| Compound Name | N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide |
| PubChem CID | 14851645 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide |
| SMILES | Cc1cccc(C)c1N(CCCCCCn1ccnc1)C(=O)C(C)n1ccnc1 |
| InChI | InChI=1S/C23H31N5O/c1-19-9-8-10-20(2)22(19)28(23(29)21(3)27-16-12-25-18-27)14-7-5-4-6-13-26-15-11-24-17-26/h8-12,15-18,21H,4-7,13-14H2,1-3H3 |
| InChIKey | DSOBMNZBIWEGKD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide?
The IUPAC name of N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide (CID 14851645) is N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide.
What is the SMILES notation for N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide?
The canonical SMILES for N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide is Cc1cccc(C)c1N(CCCCCCn1ccnc1)C(=O)C(C)n1ccnc1.
What is the InChIKey of N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide?
The InChIKey is DSOBMNZBIWEGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N5O/c1-19-9-8-10-20(2)22(19)28(23(29)21(3)27-16-12-25-18-27)14-7-5-4-6-13-26-15-11-24-17-26/h8-12,15-18,21H,4-7,13-14H2,1-3H3.
What are the key properties of N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide?
N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide has a molecular weight of 393.54 g/mol, XLogP of 4.55, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)-2-imidazol-1-yl-N-(6-imidazol-1-ylhexyl)propanamide is sourced from PubChem (CID 14851645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).