C19H23N3O5 — CID 131715267
(E)-but-2-enedioic acid;N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide (PubChem CID 131715267) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide.
| Compound Name | (E)-but-2-enedioic acid;N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide |
|---|---|
| PubChem CID | 131715267 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCn1ccnc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H19N3O.C4H4O4/c1-12-5-3-6-13(2)15(12)17-14(19)7-4-9-18-10-8-16-11-18;5-3(6)1-2-4(7)8/h3,5-6,8,10-11H,4,7,9H2,1-2H3,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XONAWCDOFVCODG-WLHGVMLRSA-N |
| XLogP | 2.63 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|