C11H14N2O2 — CID 12870484
(2E,4E)-8-imidazol-1-ylocta-2,4-dienoic acid (PubChem CID 12870484) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (2E,4E)-8-imidazol-1-ylocta-2,4-dienoic acid.
| Compound Name | (2E,4E)-8-imidazol-1-ylocta-2,4-dienoic acid |
|---|---|
| PubChem CID | 12870484 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2E,4E)-8-imidazol-1-ylocta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C/CCCn1ccnc1 |
| InChI | InChI=1S/C11H14N2O2/c14-11(15)6-4-2-1-3-5-8-13-9-7-12-10-13/h1-2,4,6-7,9-10H,3,5,8H2,(H,14,15)/b2-1+,6-4+ |
| InChIKey | NWKORFLNLDSUQI-ZMVSMXTFSA-N |
| XLogP | 1.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|