C23H27N3O9 — CID 67910793
bis(but-2-enedioic acid);N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide (PubChem CID 67910793) has the molecular formula C23H27N3O9 and a molecular weight of 489.48 g/mol. Its IUPAC name is bis(but-2-enedioic acid);N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide.
| Compound Name | bis(but-2-enedioic acid);N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide |
|---|---|
| PubChem CID | 67910793 |
| Molecular Formula | C23H27N3O9 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | bis(but-2-enedioic acid);N-(2,6-dimethylphenyl)-4-imidazol-1-ylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCn1ccnc1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H19N3O.2C4H4O4/c1-12-5-3-6-13(2)15(12)17-14(19)7-4-9-18-10-8-16-11-18;2*5-3(6)1-2-4(7)8/h3,5-6,8,10-11H,4,7,9H2,1-2H3,(H,17,19);2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | DFYMWEVTUNOPJO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|